C26H26Cl2FN3O2 — CID 4237560
2-(2,4-dichlorophenoxy)-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]propanamide (PubChem CID 4237560) has the molecular formula C26H26Cl2FN3O2 and a molecular weight of 502.42 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 4237560 |
| Molecular Formula | C26H26Cl2FN3O2 |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCN(Cc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C26H26Cl2FN3O2/c1-18(34-25-11-6-20(27)16-23(25)28)26(33)30-21-7-9-22(10-8-21)32-14-12-31(13-15-32)17-19-4-2-3-5-24(19)29/h2-11,16,18H,12-15,17H2,1H3,(H,30,33) |
| InChIKey | HHOJRWLCBNKRQV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|