C21H25BrClN3O2 — CID 46540861
2-(2-bromo-4-chlorophenoxy)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide (PubChem CID 46540861) has the molecular formula C21H25BrClN3O2 and a molecular weight of 466.81 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 46540861 |
| Molecular Formula | C21H25BrClN3O2 |
| Molecular Weight | 466.81 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)C(C)Oc3ccc(Cl)cc3Br)cc2)CC1 |
| InChI | InChI=1S/C21H25BrClN3O2/c1-3-25-10-12-26(13-11-25)18-7-5-17(6-8-18)24-21(27)15(2)28-20-9-4-16(23)14-19(20)22/h4-9,14-15H,3,10-13H2,1-2H3,(H,24,27) |
| InChIKey | LQCOMGGJDDFFJH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|