About pyrrolidine;4-pyrrolidin-1-ylaniline
pyrrolidine;4-pyrrolidin-1-ylaniline (PubChem CID 70136555) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is pyrrolidine;4-pyrrolidin-1-ylaniline.
Molecular Properties
| Compound Name | pyrrolidine;4-pyrrolidin-1-ylaniline |
| PubChem CID | 70136555 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | pyrrolidine;4-pyrrolidin-1-ylaniline |
| SMILES | C1CCNC1.Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C10H14N2.C4H9N/c11-9-3-5-10(6-4-9)12-7-1-2-8-12;1-2-4-5-3-1/h3-6H,1-2,7-8,11H2;5H,1-4H2 |
| InChIKey | CEMNOMMQHUOFCM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine;4-pyrrolidin-1-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine;4-pyrrolidin-1-ylaniline?
The IUPAC name of pyrrolidine;4-pyrrolidin-1-ylaniline (CID 70136555) is pyrrolidine;4-pyrrolidin-1-ylaniline.
What is the SMILES notation for pyrrolidine;4-pyrrolidin-1-ylaniline?
The canonical SMILES for pyrrolidine;4-pyrrolidin-1-ylaniline is C1CCNC1.Nc1ccc(N2CCCC2)cc1.
What is the InChIKey of pyrrolidine;4-pyrrolidin-1-ylaniline?
The InChIKey is CEMNOMMQHUOFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C4H9N/c11-9-3-5-10(6-4-9)12-7-1-2-8-12;1-2-4-5-3-1/h3-6H,1-2,7-8,11H2;5H,1-4H2.
What are the key properties of pyrrolidine;4-pyrrolidin-1-ylaniline?
pyrrolidine;4-pyrrolidin-1-ylaniline has a molecular weight of 233.36 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine;4-pyrrolidin-1-ylaniline is sourced from PubChem (CID 70136555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).