C24H33N3OS — CID 59442898
N,N-dibutyl-8-morpholin-4-yl-10H-phenothiazin-2-amine (PubChem CID 59442898) has the molecular formula C24H33N3OS and a molecular weight of 411.62 g/mol. Its IUPAC name is N,N-dibutyl-8-morpholin-4-yl-10H-phenothiazin-2-amine.
| Compound Name | N,N-dibutyl-8-morpholin-4-yl-10H-phenothiazin-2-amine |
|---|---|
| PubChem CID | 59442898 |
| Molecular Formula | C24H33N3OS |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N,N-dibutyl-8-morpholin-4-yl-10H-phenothiazin-2-amine |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Nc1cc(N3CCOCC3)ccc1S2 |
| InChI | InChI=1S/C24H33N3OS/c1-3-5-11-26(12-6-4-2)19-7-9-23-21(17-19)25-22-18-20(8-10-24(22)29-23)27-13-15-28-16-14-27/h7-10,17-18,25H,3-6,11-16H2,1-2H3 |
| InChIKey | AODDMGBTCVVWJN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |