C29H41N3O5 — CID 11489121
ethyl 3-[N-butyl-4-[4-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]piperidin-1-yl]anilino]-3-oxopropanoate (PubChem CID 11489121) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is ethyl 3-[N-butyl-4-[4-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]piperidin-1-yl]anilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[N-butyl-4-[4-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]piperidin-1-yl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 11489121 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | ethyl 3-[N-butyl-4-[4-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]piperidin-1-yl]anilino]-3-oxopropanoate |
| SMILES | CCCCN(C(=O)CC(=O)OCC)c1ccc(N2CCC(N[C@@H](C)[C@H](O)c3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H41N3O5/c1-4-6-17-32(27(34)20-28(35)37-5-2)25-11-9-24(10-12-25)31-18-15-23(16-19-31)30-21(3)29(36)22-7-13-26(33)14-8-22/h7-14,21,23,29-30,33,36H,4-6,15-20H2,1-3H3/t21-,29-/m0/s1 |
| InChIKey | ZUZCKUMYWMVAOZ-LGGPFLRQSA-N |
| XLogP | 4.16 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|