C21H35N3O4S — CID 54132409
tert-butyl 4-[4-[2-(propylsulfamoyl)propan-2-yl]phenyl]piperazine-1-carboxylate (PubChem CID 54132409) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(propylsulfamoyl)propan-2-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(propylsulfamoyl)propan-2-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54132409 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | tert-butyl 4-[4-[2-(propylsulfamoyl)propan-2-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CCCNS(=O)(=O)C(C)(C)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H35N3O4S/c1-7-12-22-29(26,27)21(5,6)17-8-10-18(11-9-17)23-13-15-24(16-14-23)19(25)28-20(2,3)4/h8-11,22H,7,12-16H2,1-6H3 |
| InChIKey | NVGVQKQGSLYTOH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |