C17H18O4 — CID 169439024
4-[(E)-2-[2,6-bis(trideuteriomethoxy)phenyl]ethenyl]-3-methoxyphenol (PubChem CID 169439024) has the molecular formula C17H18O4 and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-[(E)-2-[2,6-bis(trideuteriomethoxy)phenyl]ethenyl]-3-methoxyphenol.
| Compound Name | 4-[(E)-2-[2,6-bis(trideuteriomethoxy)phenyl]ethenyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 169439024 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-[(E)-2-[2,6-bis(trideuteriomethoxy)phenyl]ethenyl]-3-methoxyphenol |
| SMILES | [2H]C([2H])([2H])Oc1cccc(OC([2H])([2H])[2H])c1/C=C/c1ccc(O)cc1OC |
| InChI | InChI=1S/C17H18O4/c1-19-15-5-4-6-16(20-2)14(15)10-8-12-7-9-13(18)11-17(12)21-3/h4-11,18H,1-3H3/b10-8+/i1D3,2D3 |
| InChIKey | QTKLRRLBFLUBQP-ZBQZUAQCSA-N |
| XLogP | 3.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|