C14H17BrN2O2S — CID 140519793
4-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-3-methoxyphenol bromide (PubChem CID 140519793) has the molecular formula C14H17BrN2O2S and a molecular weight of 357.27 g/mol. Its IUPAC name is 4-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-3-methoxyphenol bromide.
| Compound Name | 4-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-3-methoxyphenol bromide |
|---|---|
| PubChem CID | 140519793 |
| Molecular Formula | C14H17BrN2O2S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 4-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-3-methoxyphenol bromide |
| SMILES | CC[n+]1nc(C)sc1C=Cc1ccc(O)cc1OC.[Br-] |
| InChI | InChI=1S/C14H16N2O2S.BrH/c1-4-16-14(19-10(2)15-16)8-6-11-5-7-12(17)9-13(11)18-3;/h5-9H,4H2,1-3H3;1H |
| InChIKey | YXTUYYDMNOSDTJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 46.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|