C14H17BF4N2O2S — CID 140519762
5-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol tetrafluoroborate (PubChem CID 140519762) has the molecular formula C14H17BF4N2O2S and a molecular weight of 364.17 g/mol. Its IUPAC name is 5-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol tetrafluoroborate.
| Compound Name | 5-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol tetrafluoroborate |
|---|---|
| PubChem CID | 140519762 |
| Molecular Formula | C14H17BF4N2O2S |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol tetrafluoroborate |
| SMILES | CC[n+]1nc(C)sc1C=Cc1ccc(OC)c(O)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C14H16N2O2S.BF4/c1-4-16-14(19-10(2)15-16)8-6-11-5-7-13(18-3)12(17)9-11;2-1(3,4)5/h5-9H,4H2,1-3H3;/q;-1/p+1 |
| InChIKey | PMKNEPZKSYVUKV-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 46.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|