C16H19BF4N2O2S — CID 87829766
2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium tetrafluoroborate (PubChem CID 87829766) has the molecular formula C16H19BF4N2O2S and a molecular weight of 390.21 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium tetrafluoroborate.
| Compound Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 87829766 |
| Molecular Formula | C16H19BF4N2O2S |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium tetrafluoroborate |
| SMILES | C=CC[n+]1nc(C)sc1/C=C/c1ccc(OC)c(OC)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C16H19N2O2S.BF4/c1-5-10-18-16(21-12(2)17-18)9-7-13-6-8-14(19-3)15(11-13)20-4;2-1(3,4)5/h5-9,11H,1,10H2,2-4H3;/q+1;-1/b9-7+; |
| InChIKey | WWEIIQSRVHWJJJ-BXTVWIJMSA-N |
| XLogP | 4.41 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|