C15H16O2S — CID 18738932
2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methylthiophene (PubChem CID 18738932) has the molecular formula C15H16O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methylthiophene.
| Compound Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methylthiophene |
|---|---|
| PubChem CID | 18738932 |
| Molecular Formula | C15H16O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methylthiophene |
| SMILES | COc1ccc(/C=C/c2ccc(C)s2)cc1OC |
| InChI | InChI=1S/C15H16O2S/c1-11-4-7-13(18-11)8-5-12-6-9-14(16-2)15(10-12)17-3/h4-10H,1-3H3/b8-5+ |
| InChIKey | NLUCGPUTPHQWST-VMPITWQZSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |