C17H21N2O3S+ — CID 87828617
5-methyl-3-prop-2-enyl-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium (PubChem CID 87828617) has the molecular formula C17H21N2O3S+ and a molecular weight of 333.43 g/mol. Its IUPAC name is 5-methyl-3-prop-2-enyl-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium.
| Compound Name | 5-methyl-3-prop-2-enyl-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium |
|---|---|
| PubChem CID | 87828617 |
| Molecular Formula | C17H21N2O3S+ |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 5-methyl-3-prop-2-enyl-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium |
| SMILES | C=CC[n+]1nc(C)sc1/C=C/c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C17H21N2O3S/c1-6-11-19-15(23-12(2)18-19)10-8-13-7-9-14(20-3)17(22-5)16(13)21-4/h6-10H,1,11H2,2-5H3/q+1/b10-8+ |
| InChIKey | RFUQMAYCLXPMER-CSKARUKUSA-N |
| XLogP | 3.12 |
| TPSA | 44.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|