C14H17N2O2S+ — CID 69423081
3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol (PubChem CID 69423081) has the molecular formula C14H17N2O2S+ and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol.
| Compound Name | 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 69423081 |
| Molecular Formula | C14H17N2O2S+ |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol |
| SMILES | CC[n+]1nc(C)sc1C=Cc1cccc(O)c1OC |
| InChI | InChI=1S/C14H16N2O2S/c1-4-16-13(19-10(2)15-16)9-8-11-6-5-7-12(17)14(11)18-3/h5-9H,4H2,1-3H3/p+1 |
| InChIKey | GCSKBVSACAVFND-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 46.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|