C14H15N2O2S+ — CID 136638696
3-[2-(5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol (PubChem CID 136638696) has the molecular formula C14H15N2O2S+ and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[2-(5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol.
| Compound Name | 3-[2-(5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136638696 |
| Molecular Formula | C14H15N2O2S+ |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[2-(5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol |
| SMILES | C=CC[n+]1nc(C)sc1C=Cc1cccc(O)c1O |
| InChI | InChI=1S/C14H14N2O2S/c1-3-9-16-13(19-10(2)15-16)8-7-11-5-4-6-12(17)14(11)18/h3-8,17H,1,9H2,2H3/p+1 |
| InChIKey | WCFFKUQKSDVUBY-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|