C14H15BrN2O2S — CID 140519769
2-[2-(5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]benzene-1,4-diol bromide (PubChem CID 140519769) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is 2-[2-(5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]benzene-1,4-diol bromide.
| Compound Name | 2-[2-(5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]benzene-1,4-diol bromide |
|---|---|
| PubChem CID | 140519769 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-[2-(5-methyl-3-prop-2-enyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]benzene-1,4-diol bromide |
| SMILES | C=CC[n+]1nc(C)sc1C=Cc1cc(O)ccc1O.[Br-] |
| InChI | InChI=1S/C14H14N2O2S.BrH/c1-3-8-16-14(19-10(2)15-16)7-4-11-9-12(17)5-6-13(11)18;/h3-7,9,17H,1,8H2,2H3;1H |
| InChIKey | LDJBNIKTEBQOME-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 57.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|