C17H16O3S — CID 91216363
O-[[4-[2-(2,5-dihydroxyphenyl)ethenyl]phenyl]methyl] ethanethioate (PubChem CID 91216363) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is O-[[4-[2-(2,5-dihydroxyphenyl)ethenyl]phenyl]methyl] ethanethioate.
| Compound Name | O-[[4-[2-(2,5-dihydroxyphenyl)ethenyl]phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 91216363 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | O-[[4-[2-(2,5-dihydroxyphenyl)ethenyl]phenyl]methyl] ethanethioate |
| SMILES | CC(=S)OCc1ccc(C=Cc2cc(O)ccc2O)cc1 |
| InChI | InChI=1S/C17H16O3S/c1-12(21)20-11-14-4-2-13(3-5-14)6-7-15-10-16(18)8-9-17(15)19/h2-10,18-19H,11H2,1H3 |
| InChIKey | IFRHVKLCUGJYAY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|