About O-(pyridin-4-ylmethyl) ethanethioate
O-(pyridin-4-ylmethyl) ethanethioate (PubChem CID 75412608) has the molecular formula C8H9NOS
and a molecular weight of 167.23 g/mol. Its IUPAC name is O-(pyridin-4-ylmethyl) ethanethioate.
Molecular Properties
| Compound Name | O-(pyridin-4-ylmethyl) ethanethioate |
| PubChem CID | 75412608 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | O-(pyridin-4-ylmethyl) ethanethioate |
| SMILES | CC(=S)OCc1ccncc1 |
| InChI | InChI=1S/C8H9NOS/c1-7(11)10-6-8-2-4-9-5-3-8/h2-5H,6H2,1H3 |
| InChIKey | OQHZNAQPACAFMT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(pyridin-4-ylmethyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(pyridin-4-ylmethyl) ethanethioate?
The IUPAC name of O-(pyridin-4-ylmethyl) ethanethioate (CID 75412608) is O-(pyridin-4-ylmethyl) ethanethioate.
What is the SMILES notation for O-(pyridin-4-ylmethyl) ethanethioate?
The canonical SMILES for O-(pyridin-4-ylmethyl) ethanethioate is CC(=S)OCc1ccncc1.
What is the InChIKey of O-(pyridin-4-ylmethyl) ethanethioate?
The InChIKey is OQHZNAQPACAFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS/c1-7(11)10-6-8-2-4-9-5-3-8/h2-5H,6H2,1H3.
What are the key properties of O-(pyridin-4-ylmethyl) ethanethioate?
O-(pyridin-4-ylmethyl) ethanethioate has a molecular weight of 167.23 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(pyridin-4-ylmethyl) ethanethioate is sourced from PubChem (CID 75412608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).