C14H22O2SSi — CID 59806211
O-[[4-(2-trimethylsilylethoxy)phenyl]methyl] ethanethioate (PubChem CID 59806211) has the molecular formula C14H22O2SSi and a molecular weight of 282.48 g/mol. Its IUPAC name is O-[[4-(2-trimethylsilylethoxy)phenyl]methyl] ethanethioate.
| Compound Name | O-[[4-(2-trimethylsilylethoxy)phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 59806211 |
| Molecular Formula | C14H22O2SSi |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | O-[[4-(2-trimethylsilylethoxy)phenyl]methyl] ethanethioate |
| SMILES | CC(=S)OCc1ccc(OCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C14H22O2SSi/c1-12(17)16-11-13-5-7-14(8-6-13)15-9-10-18(2,3)4/h5-8H,9-11H2,1-4H3 |
| InChIKey | DSOFKJNAHXIQLX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|