C17H31ClO2Si2 — CID 123328360
chloro-dimethyl-[3-[4-(3-trimethylsilylpropoxy)phenoxy]propyl]silane (PubChem CID 123328360) has the molecular formula C17H31ClO2Si2 and a molecular weight of 359.06 g/mol. Its IUPAC name is chloro-dimethyl-[3-[4-(3-trimethylsilylpropoxy)phenoxy]propyl]silane.
| Compound Name | chloro-dimethyl-[3-[4-(3-trimethylsilylpropoxy)phenoxy]propyl]silane |
|---|---|
| PubChem CID | 123328360 |
| Molecular Formula | C17H31ClO2Si2 |
| Molecular Weight | 359.06 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | chloro-dimethyl-[3-[4-(3-trimethylsilylpropoxy)phenoxy]propyl]silane |
| SMILES | C[Si](C)(C)CCCOc1ccc(OCCC[Si](C)(C)Cl)cc1 |
| InChI | InChI=1S/C17H31ClO2Si2/c1-21(2,3)14-6-12-19-16-8-10-17(11-9-16)20-13-7-15-22(4,5)18/h8-11H,6-7,12-15H2,1-5H3 |
| InChIKey | QHMGRGYQCQVEHQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.06 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|