C27H42O4Si2 — CID 159703076
4-[[butyl(dimethyl)silyl]methoxy]benzaldehyde;4-(3-trimethylsilylpropoxy)benzaldehyde (PubChem CID 159703076) has the molecular formula C27H42O4Si2 and a molecular weight of 486.80 g/mol. Its IUPAC name is 4-[[butyl(dimethyl)silyl]methoxy]benzaldehyde;4-(3-trimethylsilylpropoxy)benzaldehyde.
| Compound Name | 4-[[butyl(dimethyl)silyl]methoxy]benzaldehyde;4-(3-trimethylsilylpropoxy)benzaldehyde |
|---|---|
| PubChem CID | 159703076 |
| Molecular Formula | C27H42O4Si2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 4-[[butyl(dimethyl)silyl]methoxy]benzaldehyde;4-(3-trimethylsilylpropoxy)benzaldehyde |
| SMILES | CCCC[Si](C)(C)COc1ccc(C=O)cc1.C[Si](C)(C)CCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C14H22O2Si.C13H20O2Si/c1-4-5-10-17(2,3)12-16-14-8-6-13(11-15)7-9-14;1-16(2,3)10-4-9-15-13-7-5-12(11-14)6-8-13/h6-9,11H,4-5,10,12H2,1-3H3;5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | MXWIHLVZKUGUES-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|