C24H43NO2Si — CID 58983689
trimethyl-[3-[4-[1-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yl]phenoxy]propyl]silane (PubChem CID 58983689) has the molecular formula C24H43NO2Si and a molecular weight of 405.70 g/mol. Its IUPAC name is trimethyl-[3-[4-[1-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yl]phenoxy]propyl]silane.
| Compound Name | trimethyl-[3-[4-[1-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yl]phenoxy]propyl]silane |
|---|---|
| PubChem CID | 58983689 |
| Molecular Formula | C24H43NO2Si |
| Molecular Weight | 405.70 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | trimethyl-[3-[4-[1-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yl]phenoxy]propyl]silane |
| SMILES | CC(CON1C(C)(C)CCCC1(C)C)c1ccc(OCCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C24H43NO2Si/c1-20(19-27-25-23(2,3)15-9-16-24(25,4)5)21-11-13-22(14-12-21)26-17-10-18-28(6,7)8/h11-14,20H,9-10,15-19H2,1-8H3 |
| InChIKey | HCEDMWHJPMSTKS-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|