C21H34LiNO5S — CID 58983799
lithium 2,2,6,6-tetramethyl-1-[2-[3-(3-oxidoperoxysulfanylpropoxy)phenyl]propoxy]piperidine (PubChem CID 58983799) has the molecular formula C21H34LiNO5S and a molecular weight of 419.51 g/mol. Its IUPAC name is lithium 2,2,6,6-tetramethyl-1-[2-[3-(3-oxidoperoxysulfanylpropoxy)phenyl]propoxy]piperidine.
| Compound Name | lithium 2,2,6,6-tetramethyl-1-[2-[3-(3-oxidoperoxysulfanylpropoxy)phenyl]propoxy]piperidine |
|---|---|
| PubChem CID | 58983799 |
| Molecular Formula | C21H34LiNO5S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | lithium 2,2,6,6-tetramethyl-1-[2-[3-(3-oxidoperoxysulfanylpropoxy)phenyl]propoxy]piperidine |
| SMILES | CC(CON1C(C)(C)CCCC1(C)C)c1cccc(OCCCSOO[O-])c1.[Li+] |
| InChI | InChI=1S/C21H35NO5S.Li/c1-17(16-25-22-20(2,3)11-7-12-21(22,4)5)18-9-6-10-19(15-18)24-13-8-14-28-27-26-23;/h6,9-10,15,17,23H,7-8,11-14,16H2,1-5H3;/q;+1/p-1 |
| InChIKey | ODVDGTYBPBITAW-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|