C16H25NO3S — CID 65003158
[1-[(3-propan-2-ylphenoxy)methyl]cyclopentyl]methanesulfonamide (PubChem CID 65003158) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is [1-[(3-propan-2-ylphenoxy)methyl]cyclopentyl]methanesulfonamide.
| Compound Name | [1-[(3-propan-2-ylphenoxy)methyl]cyclopentyl]methanesulfonamide |
|---|---|
| PubChem CID | 65003158 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [1-[(3-propan-2-ylphenoxy)methyl]cyclopentyl]methanesulfonamide |
| SMILES | CC(C)c1cccc(OCC2(CS(N)(=O)=O)CCCC2)c1 |
| InChI | InChI=1S/C16H25NO3S/c1-13(2)14-6-5-7-15(10-14)20-11-16(8-3-4-9-16)12-21(17,18)19/h5-7,10,13H,3-4,8-9,11-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | ASNJVCUSMVGKFO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |