About [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide
[1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide (PubChem CID 81265285) has the molecular formula C14H19F2NO3S
and a molecular weight of 319.37 g/mol. Its IUPAC name is [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide.
Molecular Properties
| Compound Name | [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide |
| PubChem CID | 81265285 |
| Molecular Formula | C14H19F2NO3S |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(COc2c(F)cccc2F)CCCCC1 |
| InChI | InChI=1S/C14H19F2NO3S/c15-11-5-4-6-12(16)13(11)20-9-14(10-21(17,18)19)7-2-1-3-8-14/h4-6H,1-3,7-10H2,(H2,17,18,19) |
| InChIKey | VDQVNYURWDDNNB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide?
The IUPAC name of [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide (CID 81265285) is [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide.
What is the SMILES notation for [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide?
The canonical SMILES for [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide is NS(=O)(=O)CC1(COc2c(F)cccc2F)CCCCC1.
What is the InChIKey of [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide?
The InChIKey is VDQVNYURWDDNNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO3S/c15-11-5-4-6-12(16)13(11)20-9-14(10-21(17,18)19)7-2-1-3-8-14/h4-6H,1-3,7-10H2,(H2,17,18,19).
What are the key properties of [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide?
[1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide has a molecular weight of 319.37 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2,6-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide is sourced from PubChem (CID 81265285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).