C15H22ClNO3S — CID 65010191
[1-[(3-chlorophenoxy)methyl]cycloheptyl]methanesulfonamide (PubChem CID 65010191) has the molecular formula C15H22ClNO3S and a molecular weight of 331.86 g/mol. Its IUPAC name is [1-[(3-chlorophenoxy)methyl]cycloheptyl]methanesulfonamide.
| Compound Name | [1-[(3-chlorophenoxy)methyl]cycloheptyl]methanesulfonamide |
|---|---|
| PubChem CID | 65010191 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.86 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [1-[(3-chlorophenoxy)methyl]cycloheptyl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(COc2cccc(Cl)c2)CCCCCC1 |
| InChI | InChI=1S/C15H22ClNO3S/c16-13-6-5-7-14(10-13)20-11-15(12-21(17,18)19)8-3-1-2-4-9-15/h5-7,10H,1-4,8-9,11-12H2,(H2,17,18,19) |
| InChIKey | AEPFGZRHNBAJKY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |