C16H23ClO3S — CID 65009941
[1-[(3-methylphenoxy)methyl]cycloheptyl]methanesulfonyl chloride (PubChem CID 65009941) has the molecular formula C16H23ClO3S and a molecular weight of 330.88 g/mol. Its IUPAC name is [1-[(3-methylphenoxy)methyl]cycloheptyl]methanesulfonyl chloride.
| Compound Name | [1-[(3-methylphenoxy)methyl]cycloheptyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 65009941 |
| Molecular Formula | C16H23ClO3S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [1-[(3-methylphenoxy)methyl]cycloheptyl]methanesulfonyl chloride |
| SMILES | Cc1cccc(OCC2(CS(=O)(=O)Cl)CCCCCC2)c1 |
| InChI | InChI=1S/C16H23ClO3S/c1-14-7-6-8-15(11-14)20-12-16(13-21(17,18)19)9-4-2-3-5-10-16/h6-8,11H,2-5,9-10,12-13H2,1H3 |
| InChIKey | ATHSLCAMUUIWNG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |