C14H18BrClO3S — CID 107286836
[1-[(5-bromo-2-methylphenoxy)methyl]cyclopentyl]methanesulfonyl chloride (PubChem CID 107286836) has the molecular formula C14H18BrClO3S and a molecular weight of 381.72 g/mol. Its IUPAC name is [1-[(5-bromo-2-methylphenoxy)methyl]cyclopentyl]methanesulfonyl chloride.
| Compound Name | [1-[(5-bromo-2-methylphenoxy)methyl]cyclopentyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 107286836 |
| Molecular Formula | C14H18BrClO3S |
| Molecular Weight | 381.72 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | [1-[(5-bromo-2-methylphenoxy)methyl]cyclopentyl]methanesulfonyl chloride |
| SMILES | Cc1ccc(Br)cc1OCC1(CS(=O)(=O)Cl)CCCC1 |
| InChI | InChI=1S/C14H18BrClO3S/c1-11-4-5-12(15)8-13(11)19-9-14(6-2-3-7-14)10-20(16,17)18/h4-5,8H,2-3,6-7,9-10H2,1H3 |
| InChIKey | ZBLDHSCQNALAAU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |