C13H16BrNOS — CID 107283905
2-[1-[(5-bromo-2-methylphenoxy)methyl]cyclopropyl]ethanethioamide (PubChem CID 107283905) has the molecular formula C13H16BrNOS and a molecular weight of 314.25 g/mol. Its IUPAC name is 2-[1-[(5-bromo-2-methylphenoxy)methyl]cyclopropyl]ethanethioamide.
| Compound Name | 2-[1-[(5-bromo-2-methylphenoxy)methyl]cyclopropyl]ethanethioamide |
|---|---|
| PubChem CID | 107283905 |
| Molecular Formula | C13H16BrNOS |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-[1-[(5-bromo-2-methylphenoxy)methyl]cyclopropyl]ethanethioamide |
| SMILES | Cc1ccc(Br)cc1OCC1(CC(N)=S)CC1 |
| InChI | InChI=1S/C13H16BrNOS/c1-9-2-3-10(14)6-11(9)16-8-13(4-5-13)7-12(15)17/h2-3,6H,4-5,7-8H2,1H3,(H2,15,17) |
| InChIKey | PLWQFVNBNVGDTL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|