C14H18ClNOS — CID 65495785
2-[1-[(4-chloro-3,5-dimethylphenoxy)methyl]cyclopropyl]ethanethioamide (PubChem CID 65495785) has the molecular formula C14H18ClNOS and a molecular weight of 283.82 g/mol. Its IUPAC name is 2-[1-[(4-chloro-3,5-dimethylphenoxy)methyl]cyclopropyl]ethanethioamide.
| Compound Name | 2-[1-[(4-chloro-3,5-dimethylphenoxy)methyl]cyclopropyl]ethanethioamide |
|---|---|
| PubChem CID | 65495785 |
| Molecular Formula | C14H18ClNOS |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-[1-[(4-chloro-3,5-dimethylphenoxy)methyl]cyclopropyl]ethanethioamide |
| SMILES | Cc1cc(OCC2(CC(N)=S)CC2)cc(C)c1Cl |
| InChI | InChI=1S/C14H18ClNOS/c1-9-5-11(6-10(2)13(9)15)17-8-14(3-4-14)7-12(16)18/h5-6H,3-4,7-8H2,1-2H3,(H2,16,18) |
| InChIKey | XZDKUWXLLGOSQW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|