C12H13BrClNOS — CID 65498113
2-[1-[(2-bromo-4-chlorophenoxy)methyl]cyclopropyl]ethanethioamide (PubChem CID 65498113) has the molecular formula C12H13BrClNOS and a molecular weight of 334.67 g/mol. Its IUPAC name is 2-[1-[(2-bromo-4-chlorophenoxy)methyl]cyclopropyl]ethanethioamide.
| Compound Name | 2-[1-[(2-bromo-4-chlorophenoxy)methyl]cyclopropyl]ethanethioamide |
|---|---|
| PubChem CID | 65498113 |
| Molecular Formula | C12H13BrClNOS |
| Molecular Weight | 334.67 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-[1-[(2-bromo-4-chlorophenoxy)methyl]cyclopropyl]ethanethioamide |
| SMILES | NC(=S)CC1(COc2ccc(Cl)cc2Br)CC1 |
| InChI | InChI=1S/C12H13BrClNOS/c13-9-5-8(14)1-2-10(9)16-7-12(3-4-12)6-11(15)17/h1-2,5H,3-4,6-7H2,(H2,15,17) |
| InChIKey | AJRBOLUWBAGDNI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|