C13H17BrClNO4S — CID 65006488
[4-[(2-bromo-4-chlorophenoxy)methyl]oxan-4-yl]methanesulfonamide (PubChem CID 65006488) has the molecular formula C13H17BrClNO4S and a molecular weight of 398.71 g/mol. Its IUPAC name is [4-[(2-bromo-4-chlorophenoxy)methyl]oxan-4-yl]methanesulfonamide.
| Compound Name | [4-[(2-bromo-4-chlorophenoxy)methyl]oxan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 65006488 |
| Molecular Formula | C13H17BrClNO4S |
| Molecular Weight | 398.71 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | [4-[(2-bromo-4-chlorophenoxy)methyl]oxan-4-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(COc2ccc(Cl)cc2Br)CCOCC1 |
| InChI | InChI=1S/C13H17BrClNO4S/c14-11-7-10(15)1-2-12(11)20-8-13(9-21(16,17)18)3-5-19-6-4-13/h1-2,7H,3-6,8-9H2,(H2,16,17,18) |
| InChIKey | DYULRXOZAVJVAL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |