C13H17F2NO4S — CID 65006053
[4-[(2,3-difluorophenoxy)methyl]oxan-4-yl]methanesulfonamide (PubChem CID 65006053) has the molecular formula C13H17F2NO4S and a molecular weight of 321.34 g/mol. Its IUPAC name is [4-[(2,3-difluorophenoxy)methyl]oxan-4-yl]methanesulfonamide.
| Compound Name | [4-[(2,3-difluorophenoxy)methyl]oxan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 65006053 |
| Molecular Formula | C13H17F2NO4S |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [4-[(2,3-difluorophenoxy)methyl]oxan-4-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(COc2cccc(F)c2F)CCOCC1 |
| InChI | InChI=1S/C13H17F2NO4S/c14-10-2-1-3-11(12(10)15)20-8-13(9-21(16,17)18)4-6-19-7-5-13/h1-3H,4-9H2,(H2,16,17,18) |
| InChIKey | ZDOMGSBBWAPLHW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |