C13H15BrF2O2 — CID 65004281
4-(bromomethyl)-4-[(2,3-difluorophenoxy)methyl]oxane (PubChem CID 65004281) has the molecular formula C13H15BrF2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 4-(bromomethyl)-4-[(2,3-difluorophenoxy)methyl]oxane.
| Compound Name | 4-(bromomethyl)-4-[(2,3-difluorophenoxy)methyl]oxane |
|---|---|
| PubChem CID | 65004281 |
| Molecular Formula | C13H15BrF2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-(bromomethyl)-4-[(2,3-difluorophenoxy)methyl]oxane |
| SMILES | Fc1cccc(OCC2(CBr)CCOCC2)c1F |
| InChI | InChI=1S/C13H15BrF2O2/c14-8-13(4-6-17-7-5-13)9-18-11-3-1-2-10(15)12(11)16/h1-3H,4-9H2 |
| InChIKey | BKECRGLQWPSQLZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|