C14H19F2NO3S — CID 65007096
[1-[(2,3-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide (PubChem CID 65007096) has the molecular formula C14H19F2NO3S and a molecular weight of 319.37 g/mol. Its IUPAC name is [1-[(2,3-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide.
| Compound Name | [1-[(2,3-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 65007096 |
| Molecular Formula | C14H19F2NO3S |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [1-[(2,3-difluorophenoxy)methyl]cyclohexyl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(COc2cccc(F)c2F)CCCCC1 |
| InChI | InChI=1S/C14H19F2NO3S/c15-11-5-4-6-12(13(11)16)20-9-14(10-21(17,18)19)7-2-1-3-8-14/h4-6H,1-3,7-10H2,(H2,17,18,19) |
| InChIKey | VRCMLURTSVDDBH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |