C9H16F3NO4S — CID 65005853
[4-(2,2,2-trifluoroethoxymethyl)oxan-4-yl]methanesulfonamide (PubChem CID 65005853) has the molecular formula C9H16F3NO4S and a molecular weight of 291.29 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxymethyl)oxan-4-yl]methanesulfonamide.
| Compound Name | [4-(2,2,2-trifluoroethoxymethyl)oxan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 65005853 |
| Molecular Formula | C9H16F3NO4S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxymethyl)oxan-4-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(COCC(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C9H16F3NO4S/c10-9(11,12)6-17-5-8(7-18(13,14)15)1-3-16-4-2-8/h1-7H2,(H2,13,14,15) |
| InChIKey | DKERQWUSXRUGML-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |