C10H19F2NO3S — CID 82010399
[1-(2,2-difluoroethoxymethyl)cyclohexyl]methanesulfonamide (PubChem CID 82010399) has the molecular formula C10H19F2NO3S and a molecular weight of 271.33 g/mol. Its IUPAC name is [1-(2,2-difluoroethoxymethyl)cyclohexyl]methanesulfonamide.
| Compound Name | [1-(2,2-difluoroethoxymethyl)cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 82010399 |
| Molecular Formula | C10H19F2NO3S |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [1-(2,2-difluoroethoxymethyl)cyclohexyl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(COCC(F)F)CCCCC1 |
| InChI | InChI=1S/C10H19F2NO3S/c11-9(12)6-16-7-10(8-17(13,14)15)4-2-1-3-5-10/h9H,1-8H2,(H2,13,14,15) |
| InChIKey | DGDBUQGQDJCFRZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |