C10H18F3NO3S — CID 65006896
[1-(2,2,2-trifluoroethoxymethyl)cyclohexyl]methanesulfonamide (PubChem CID 65006896) has the molecular formula C10H18F3NO3S and a molecular weight of 289.32 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroethoxymethyl)cyclohexyl]methanesulfonamide.
| Compound Name | [1-(2,2,2-trifluoroethoxymethyl)cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 65006896 |
| Molecular Formula | C10H18F3NO3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [1-(2,2,2-trifluoroethoxymethyl)cyclohexyl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(COCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C10H18F3NO3S/c11-10(12,13)7-17-6-9(8-18(14,15)16)4-2-1-3-5-9/h1-8H2,(H2,14,15,16) |
| InChIKey | CVNOXMQCMZMIPW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |