C10H16BrF3O2 — CID 66050172
4-(bromomethyl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]oxane (PubChem CID 66050172) has the molecular formula C10H16BrF3O2 and a molecular weight of 305.13 g/mol. Its IUPAC name is 4-(bromomethyl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]oxane.
| Compound Name | 4-(bromomethyl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]oxane |
|---|---|
| PubChem CID | 66050172 |
| Molecular Formula | C10H16BrF3O2 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-(bromomethyl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]oxane |
| SMILES | FC(F)(F)COCCC1(CBr)CCOCC1 |
| InChI | InChI=1S/C10H16BrF3O2/c11-7-9(1-4-15-5-2-9)3-6-16-8-10(12,13)14/h1-8H2 |
| InChIKey | GGLLNEADENSIGW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|