C14H18Cl2O4S — CID 65004623
[4-[(2-chloro-5-methylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride (PubChem CID 65004623) has the molecular formula C14H18Cl2O4S and a molecular weight of 353.27 g/mol. Its IUPAC name is [4-[(2-chloro-5-methylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride.
| Compound Name | [4-[(2-chloro-5-methylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 65004623 |
| Molecular Formula | C14H18Cl2O4S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | [4-[(2-chloro-5-methylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride |
| SMILES | Cc1ccc(Cl)c(OCC2(CS(=O)(=O)Cl)CCOCC2)c1 |
| InChI | InChI=1S/C14H18Cl2O4S/c1-11-2-3-12(15)13(8-11)20-9-14(10-21(16,17)18)4-6-19-7-5-14/h2-3,8H,4-7,9-10H2,1H3 |
| InChIKey | BRCBMMMWSLPIDA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |