C12H14N2O — CID 142944117
N-[(2E)-3-(pyridin-4-ylmethoxy)penta-2,4-dien-2-yl]methanimine (PubChem CID 142944117) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is N-[(2E)-3-(pyridin-4-ylmethoxy)penta-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2E)-3-(pyridin-4-ylmethoxy)penta-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 142944117 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-[(2E)-3-(pyridin-4-ylmethoxy)penta-2,4-dien-2-yl]methanimine |
| SMILES | C=C/C(OCc1ccncc1)=C(/C)N=C |
| InChI | InChI=1S/C12H14N2O/c1-4-12(10(2)13-3)15-9-11-5-7-14-8-6-11/h4-8H,1,3,9H2,2H3/b12-10+ |
| InChIKey | DABOKHTWKGWEDN-ZRDIBKRKSA-N |
| XLogP | 2.72 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|