About benzyl N-methylprop-2-enimidate
benzyl N-methylprop-2-enimidate (PubChem CID 123917828) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is benzyl N-methylprop-2-enimidate.
Molecular Properties
| Compound Name | benzyl N-methylprop-2-enimidate |
| PubChem CID | 123917828 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | benzyl N-methylprop-2-enimidate |
| SMILES | C=C/C(=N\C)OCc1ccccc1 |
| InChI | InChI=1S/C11H13NO/c1-3-11(12-2)13-9-10-7-5-4-6-8-10/h3-8H,1,9H2,2H3/b12-11+ |
| InChIKey | KBCGKZGTVYSPCS-VAWYXSNFSA-N |
| XLogP | 2.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-methylprop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-methylprop-2-enimidate?
The IUPAC name of benzyl N-methylprop-2-enimidate (CID 123917828) is benzyl N-methylprop-2-enimidate.
What is the SMILES notation for benzyl N-methylprop-2-enimidate?
The canonical SMILES for benzyl N-methylprop-2-enimidate is C=C/C(=N\C)OCc1ccccc1.
What is the InChIKey of benzyl N-methylprop-2-enimidate?
The InChIKey is KBCGKZGTVYSPCS-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H13NO/c1-3-11(12-2)13-9-10-7-5-4-6-8-10/h3-8H,1,9H2,2H3/b12-11+.
What are the key properties of benzyl N-methylprop-2-enimidate?
benzyl N-methylprop-2-enimidate has a molecular weight of 175.23 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-methylprop-2-enimidate is sourced from PubChem (CID 123917828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).