C15H19NO — CID 126706776
benzyl N-[(1Z)-3-methylpenta-1,4-dienyl]ethanimidate (PubChem CID 126706776) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is benzyl N-[(1Z)-3-methylpenta-1,4-dienyl]ethanimidate.
| Compound Name | benzyl N-[(1Z)-3-methylpenta-1,4-dienyl]ethanimidate |
|---|---|
| PubChem CID | 126706776 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | benzyl N-[(1Z)-3-methylpenta-1,4-dienyl]ethanimidate |
| SMILES | C=CC(C)/C=C\N=C(/C)OCc1ccccc1 |
| InChI | InChI=1S/C15H19NO/c1-4-13(2)10-11-16-14(3)17-12-15-8-6-5-7-9-15/h4-11,13H,1,12H2,2-3H3/b11-10-,16-14+ |
| InChIKey | CDJGASHNNUWCQU-XHINVYKMSA-N |
| XLogP | 3.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|