C19H30N4O — CID 144769086
(4-amino-4-iminobutyl) N-methylprop-2-enimidate;N-benzylbut-3-en-2-amine (PubChem CID 144769086) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is (4-amino-4-iminobutyl) N-methylprop-2-enimidate;N-benzylbut-3-en-2-amine.
| Compound Name | (4-amino-4-iminobutyl) N-methylprop-2-enimidate;N-benzylbut-3-en-2-amine |
|---|---|
| PubChem CID | 144769086 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (4-amino-4-iminobutyl) N-methylprop-2-enimidate;N-benzylbut-3-en-2-amine |
| SMILES | C=CC(C)NCc1ccccc1.[H]/N=C(\N)CCCO/C(C=C)=N/C |
| InChI | InChI=1S/C11H15N.C8H15N3O/c1-3-10(2)12-9-11-7-5-4-6-8-11;1-3-8(11-2)12-6-4-5-7(9)10/h3-8,10,12H,1,9H2,2H3;3H,1,4-6H2,2H3,(H3,9,10)/b;11-8+ |
| InChIKey | LILHKGBTABIALP-IBMQDACXSA-N |
| XLogP | 3.28 |
| TPSA | 83.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|