About pyridin-4-ylmethyl N-(diaminomethylidene)carbamate
pyridin-4-ylmethyl N-(diaminomethylidene)carbamate (PubChem CID 175822954) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is pyridin-4-ylmethyl N-(diaminomethylidene)carbamate.
Molecular Properties
| Compound Name | pyridin-4-ylmethyl N-(diaminomethylidene)carbamate |
| PubChem CID | 175822954 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | pyridin-4-ylmethyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1ccncc1 |
| InChI | InChI=1S/C8H10N4O2/c9-7(10)12-8(13)14-5-6-1-3-11-4-2-6/h1-4H,5H2,(H4,9,10,12,13) |
| InChIKey | DSOALVHGFNYPDF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze pyridin-4-ylmethyl N-(diaminomethylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-ylmethyl N-(diaminomethylidene)carbamate?
The IUPAC name of pyridin-4-ylmethyl N-(diaminomethylidene)carbamate (CID 175822954) is pyridin-4-ylmethyl N-(diaminomethylidene)carbamate.
What is the SMILES notation for pyridin-4-ylmethyl N-(diaminomethylidene)carbamate?
The canonical SMILES for pyridin-4-ylmethyl N-(diaminomethylidene)carbamate is NC(N)=NC(=O)OCc1ccncc1.
What is the InChIKey of pyridin-4-ylmethyl N-(diaminomethylidene)carbamate?
The InChIKey is DSOALVHGFNYPDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c9-7(10)12-8(13)14-5-6-1-3-11-4-2-6/h1-4H,5H2,(H4,9,10,12,13).
What are the key properties of pyridin-4-ylmethyl N-(diaminomethylidene)carbamate?
pyridin-4-ylmethyl N-(diaminomethylidene)carbamate has a molecular weight of 194.19 g/mol, XLogP of -0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-ylmethyl N-(diaminomethylidene)carbamate is sourced from PubChem (CID 175822954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).