C21H24O4 — CID 141206189
3-[(1E,6E)-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-dienyl]-2-methoxyphenol (PubChem CID 141206189) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[(1E,6E)-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-dienyl]-2-methoxyphenol.
| Compound Name | 3-[(1E,6E)-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-dienyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 141206189 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-[(1E,6E)-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-dienyl]-2-methoxyphenol |
| SMILES | COc1ccc(/C=C/CCC/C=C/c2cccc(O)c2OC)cc1O |
| InChI | InChI=1S/C21H24O4/c1-24-20-14-13-16(15-19(20)23)9-6-4-3-5-7-10-17-11-8-12-18(22)21(17)25-2/h6-15,22-23H,3-5H2,1-2H3/b9-6+,10-7+ |
| InChIKey | GAULFUVGOWDPBO-KZZDLZNXSA-N |
| XLogP | 5.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|