C11H12O3 — CID 54191678
3-(2,6-dimethoxyphenyl)prop-2-enal (PubChem CID 54191678) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenyl)prop-2-enal.
| Compound Name | 3-(2,6-dimethoxyphenyl)prop-2-enal |
|---|---|
| PubChem CID | 54191678 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3-(2,6-dimethoxyphenyl)prop-2-enal |
| SMILES | COc1cccc(OC)c1C=CC=O |
| InChI | InChI=1S/C11H12O3/c1-13-10-6-3-7-11(14-2)9(10)5-4-8-12/h3-8H,1-2H3 |
| InChIKey | IVYUWTPPGFCIMY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|