C31H28NO4P — CID 87420776
(2E,4E)-5-(2,6-dimethoxyphenyl)-2-[(triphenyl-λ5-phosphanylidene)amino]penta-2,4-dienoic acid (PubChem CID 87420776) has the molecular formula C31H28NO4P and a molecular weight of 509.54 g/mol. Its IUPAC name is (2E,4E)-5-(2,6-dimethoxyphenyl)-2-[(triphenyl-λ5-phosphanylidene)amino]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(2,6-dimethoxyphenyl)-2-[(triphenyl-λ5-phosphanylidene)amino]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87420776 |
| Molecular Formula | C31H28NO4P |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (2E,4E)-5-(2,6-dimethoxyphenyl)-2-[(triphenyl-λ5-phosphanylidene)amino]penta-2,4-dienoic acid |
| SMILES | COc1cccc(OC)c1/C=C/C=C(/N=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H28NO4P/c1-35-29-22-13-23-30(36-2)27(29)20-12-21-28(31(33)34)32-37(24-14-6-3-7-15-24,25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-23H,1-2H3,(H,33,34)/b20-12+,28-21+ |
| InChIKey | KSNCQDMTTXPJTE-KYGHLIQVSA-N |
| XLogP | 5.86 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|