C22H26O4 — CID 118655300
1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-methylphenyl)propan-1-one (PubChem CID 118655300) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-methylphenyl)propan-1-one.
| Compound Name | 1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 118655300 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-methylphenyl)propan-1-one |
| SMILES | COc1cc(O)c(CC=C(C)C)c(O)c1C(=O)CCc1ccc(C)cc1 |
| InChI | InChI=1S/C22H26O4/c1-14(2)5-11-17-19(24)13-20(26-4)21(22(17)25)18(23)12-10-16-8-6-15(3)7-9-16/h5-9,13,24-25H,10-12H2,1-4H3 |
| InChIKey | UNHKPGLWJSMDKT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|