C20H22NO4+ — CID 140706144
(E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-pyridin-1-ium-4-ylprop-2-en-1-one (PubChem CID 140706144) has the molecular formula C20H22NO4+ and a molecular weight of 340.40 g/mol. Its IUPAC name is (E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-pyridin-1-ium-4-ylprop-2-en-1-one.
| Compound Name | (E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-pyridin-1-ium-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 140706144 |
| Molecular Formula | C20H22NO4+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-pyridin-1-ium-4-ylprop-2-en-1-one |
| SMILES | COc1cc(O)c(CC=C(C)C)c(O)c1C(=O)/C=C/c1cc[nH+]cc1 |
| InChI | InChI=1S/C20H21NO4/c1-13(2)4-6-15-17(23)12-18(25-3)19(20(15)24)16(22)7-5-14-8-10-21-11-9-14/h4-5,7-12,23-24H,6H2,1-3H3/p+1/b7-5+ |
| InChIKey | PXVXVJVLKOLAKP-FNORWQNLSA-O |
| XLogP | 3.33 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|