C26H26NO6S+ — CID 176592755
[4-[(E)-3-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-oxoprop-1-enyl]phenyl] 2-(1,3-thiazol-3-ium-3-yl)acetate (PubChem CID 176592755) has the molecular formula C26H26NO6S+ and a molecular weight of 480.56 g/mol. Its IUPAC name is [4-[(E)-3-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-oxoprop-1-enyl]phenyl] 2-(1,3-thiazol-3-ium-3-yl)acetate.
| Compound Name | [4-[(E)-3-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-oxoprop-1-enyl]phenyl] 2-(1,3-thiazol-3-ium-3-yl)acetate |
|---|---|
| PubChem CID | 176592755 |
| Molecular Formula | C26H26NO6S+ |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [4-[(E)-3-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-oxoprop-1-enyl]phenyl] 2-(1,3-thiazol-3-ium-3-yl)acetate |
| SMILES | COc1cc(O)c(CC=C(C)C)c(O)c1C(=O)/C=C/c1ccc(OC(=O)C[n+]2ccsc2)cc1 |
| InChI | InChI=1S/C26H25NO6S/c1-17(2)4-10-20-22(29)14-23(32-3)25(26(20)31)21(28)11-7-18-5-8-19(9-6-18)33-24(30)15-27-12-13-34-16-27/h4-9,11-14,16H,10,15H2,1-3H3,(H-,28,29,31)/p+1/b11-7+ |
| InChIKey | AXOATKYUHILPEE-YRNVUSSQSA-O |
| XLogP | 4.47 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|